C20H19NO4 — CID 2614298
2-(4-methylphenoxy)ethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate (PubChem CID 2614298) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-(4-methylphenoxy)ethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate.
| Compound Name | 2-(4-methylphenoxy)ethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 2614298 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-(4-methylphenoxy)ethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1ccc(OCCOC(=O)c2c(-c3ccccc3)noc2C)cc1 |
| InChI | InChI=1S/C20H19NO4/c1-14-8-10-17(11-9-14)23-12-13-24-20(22)18-15(2)25-21-19(18)16-6-4-3-5-7-16/h3-11H,12-13H2,1-2H3 |
| InChIKey | XIPZSCZGRRSCQY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|