C19H15NO4 — CID 2648489
(4-acetylphenyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate (PubChem CID 2648489) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is (4-acetylphenyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate.
| Compound Name | (4-acetylphenyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 2648489 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (4-acetylphenyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | CC(=O)c1ccc(OC(=O)c2c(-c3ccccc3)noc2C)cc1 |
| InChI | InChI=1S/C19H15NO4/c1-12(21)14-8-10-16(11-9-14)23-19(22)17-13(2)24-20-18(17)15-6-4-3-5-7-15/h3-11H,1-2H3 |
| InChIKey | SCMHSZNJHFGABM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|