C26H22N2O3 — CID 2803466
(1,3-diphenylpropan-2-ylideneamino) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate (PubChem CID 2803466) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is (1,3-diphenylpropan-2-ylideneamino) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate.
| Compound Name | (1,3-diphenylpropan-2-ylideneamino) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 2803466 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (1,3-diphenylpropan-2-ylideneamino) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)ON=C(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H22N2O3/c1-19-24(25(28-30-19)22-15-9-4-10-16-22)26(29)31-27-23(17-20-11-5-2-6-12-20)18-21-13-7-3-8-14-21/h2-16H,17-18H2,1H3 |
| InChIKey | PJUWQHQHWGDBHU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 64.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|