C18H13NO5 — CID 3931353
1,3-benzodioxol-5-yl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate (PubChem CID 3931353) has the molecular formula C18H13NO5 and a molecular weight of 323.30 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate.
| Compound Name | 1,3-benzodioxol-5-yl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 3931353 |
| Molecular Formula | C18H13NO5 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 1,3-benzodioxol-5-yl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H13NO5/c1-11-16(17(19-24-11)12-5-3-2-4-6-12)18(20)23-13-7-8-14-15(9-13)22-10-21-14/h2-9H,10H2,1H3 |
| InChIKey | BZXUQQBCYXLAKD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|