C24H16O6 — CID 8766098
1,3-benzodioxol-5-yl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate (PubChem CID 8766098) has the molecular formula C24H16O6 and a molecular weight of 400.39 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate.
| Compound Name | 1,3-benzodioxol-5-yl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
|---|---|
| PubChem CID | 8766098 |
| Molecular Formula | C24H16O6 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 1,3-benzodioxol-5-yl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)Oc3ccc4c(c3)OCO4)cccc2c1=O |
| InChI | InChI=1S/C24H16O6/c1-14-21(25)17-8-5-9-18(23(17)30-22(14)15-6-3-2-4-7-15)24(26)29-16-10-11-19-20(12-16)28-13-27-19/h2-12H,13H2,1H3 |
| InChIKey | WQEQRTGHRAATKJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|