C19H14ClF2NO4 — CID 7825415
2-(4-fluorophenoxy)ethyl 3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 7825415) has the molecular formula C19H14ClF2NO4 and a molecular weight of 393.77 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)ethyl 3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | 2-(4-fluorophenoxy)ethyl 3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 7825415 |
| Molecular Formula | C19H14ClF2NO4 |
| Molecular Weight | 393.77 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 2-(4-fluorophenoxy)ethyl 3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1onc(-c2c(F)cccc2Cl)c1C(=O)OCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C19H14ClF2NO4/c1-11-16(18(23-27-11)17-14(20)3-2-4-15(17)22)19(24)26-10-9-25-13-7-5-12(21)6-8-13/h2-8H,9-10H2,1H3 |
| InChIKey | FIKVUQKBKRLFFQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.77 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|