C23H22ClFN2O6 — CID 27894657
[2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 27894657) has the molecular formula C23H22ClFN2O6 and a molecular weight of 476.89 g/mol. Its IUPAC name is [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 27894657 |
| Molecular Formula | C23H22ClFN2O6 |
| Molecular Weight | 476.89 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | CCOc1ccc(OCCNC(=O)COC(=O)c2c(-c3c(F)cccc3Cl)noc2C)cc1 |
| InChI | InChI=1S/C23H22ClFN2O6/c1-3-30-15-7-9-16(10-8-15)31-12-11-26-19(28)13-32-23(29)20-14(2)33-27-22(20)21-17(24)5-4-6-18(21)25/h4-10H,3,11-13H2,1-2H3,(H,26,28) |
| InChIKey | XBCGVVHVELQTND-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.89 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|