C17H18ClFN2O5 — CID 8762863
[2-(3-methoxypropylamino)-2-oxoethyl] 3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 8762863) has the molecular formula C17H18ClFN2O5 and a molecular weight of 384.79 g/mol. Its IUPAC name is [2-(3-methoxypropylamino)-2-oxoethyl] 3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | [2-(3-methoxypropylamino)-2-oxoethyl] 3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 8762863 |
| Molecular Formula | C17H18ClFN2O5 |
| Molecular Weight | 384.79 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | [2-(3-methoxypropylamino)-2-oxoethyl] 3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | COCCCNC(=O)COC(=O)c1c(-c2c(F)cccc2Cl)noc1C |
| InChI | InChI=1S/C17H18ClFN2O5/c1-10-14(17(23)25-9-13(22)20-7-4-8-24-2)16(21-26-10)15-11(18)5-3-6-12(15)19/h3,5-6H,4,7-9H2,1-2H3,(H,20,22) |
| InChIKey | GXQBFLCEMJQLEY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.79 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|