C22H14Cl3FN4O4 — CID 6293797
[(E)-[amino-[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methylidene]amino] 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 6293797) has the molecular formula C22H14Cl3FN4O4 and a molecular weight of 523.74 g/mol. Its IUPAC name is [(E)-[amino-[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methylidene]amino] 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | [(E)-[amino-[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methylidene]amino] 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 6293797 |
| Molecular Formula | C22H14Cl3FN4O4 |
| Molecular Weight | 523.74 g/mol |
| Exact Mass | 522.01 |
| IUPAC Name | [(E)-[amino-[3-(2-chloro-6-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methylidene]amino] 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)O/N=C(/N)c1c(-c2c(F)cccc2Cl)noc1C |
| InChI | InChI=1S/C22H14Cl3FN4O4/c1-9-15(19(28-32-9)18-13(25)7-4-8-14(18)26)21(27)30-34-22(31)16-10(2)33-29-20(16)17-11(23)5-3-6-12(17)24/h3-8H,1-2H3,(H2,27,30) |
| InChIKey | ZIXLTKMQVMGBGG-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 116.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.74 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|