C18H9Cl4N3O5 — CID 6368908
[(Z)-[(2,6-dichlorophenyl)-nitromethylidene]amino] 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 6368908) has the molecular formula C18H9Cl4N3O5 and a molecular weight of 489.10 g/mol. Its IUPAC name is [(Z)-[(2,6-dichlorophenyl)-nitromethylidene]amino] 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | [(Z)-[(2,6-dichlorophenyl)-nitromethylidene]amino] 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 6368908 |
| Molecular Formula | C18H9Cl4N3O5 |
| Molecular Weight | 489.10 g/mol |
| Exact Mass | 486.93 |
| IUPAC Name | [(Z)-[(2,6-dichlorophenyl)-nitromethylidene]amino] 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)O/N=C(/c1c(Cl)cccc1Cl)[N+](=O)[O-] |
| InChI | InChI=1S/C18H9Cl4N3O5/c1-8-13(16(23-29-8)14-9(19)4-2-5-10(14)20)18(26)30-24-17(25(27)28)15-11(21)6-3-7-12(15)22/h2-7H,1H3/b24-17- |
| InChIKey | WAZFEUCDNHWLAQ-ULJHMMPZSA-N |
| XLogP | 6.06 |
| TPSA | 107.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.10 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|