C17H13Cl2N5O4 — CID 2804694
3-(2,6-dichlorophenyl)-N',5-dimethyl-N'-(5-nitro-2-pyridinyl)-1,2-oxazole-4-carbohydrazide (PubChem CID 2804694) has the molecular formula C17H13Cl2N5O4 and a molecular weight of 422.23 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N',5-dimethyl-N'-(5-nitro-2-pyridinyl)-1,2-oxazole-4-carbohydrazide.
| Compound Name | 3-(2,6-dichlorophenyl)-N',5-dimethyl-N'-(5-nitro-2-pyridinyl)-1,2-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 2804694 |
| Molecular Formula | C17H13Cl2N5O4 |
| Molecular Weight | 422.23 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N',5-dimethyl-N'-(5-nitro-2-pyridinyl)-1,2-oxazole-4-carbohydrazide |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)NN(C)c1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C17H13Cl2N5O4/c1-9-14(16(22-28-9)15-11(18)4-3-5-12(15)19)17(25)21-23(2)13-7-6-10(8-20-13)24(26)27/h3-8H,1-2H3,(H,21,25) |
| InChIKey | KZUSCPDXVVAGON-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.23 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|