C18H12Cl2N4O4S — CID 10138847
3-(2,6-dichlorophenyl)-5-methyl-N'-(2-nitrobenzenecarbothioyl)-1,2-oxazole-4-carbohydrazide (PubChem CID 10138847) has the molecular formula C18H12Cl2N4O4S and a molecular weight of 451.29 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-5-methyl-N'-(2-nitrobenzenecarbothioyl)-1,2-oxazole-4-carbohydrazide.
| Compound Name | 3-(2,6-dichlorophenyl)-5-methyl-N'-(2-nitrobenzenecarbothioyl)-1,2-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 10138847 |
| Molecular Formula | C18H12Cl2N4O4S |
| Molecular Weight | 451.29 g/mol |
| Exact Mass | 450.00 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-5-methyl-N'-(2-nitrobenzenecarbothioyl)-1,2-oxazole-4-carbohydrazide |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)NNC(=S)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H12Cl2N4O4S/c1-9-14(16(23-28-9)15-11(19)6-4-7-12(15)20)17(25)21-22-18(29)10-5-2-3-8-13(10)24(26)27/h2-8H,1H3,(H,21,25)(H,22,29) |
| InChIKey | WYVVZXKBFZLBNF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.29 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|