C24H18Cl2N4O3 — CID 3695427
3-[[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-1,1-diphenylurea (PubChem CID 3695427) has the molecular formula C24H18Cl2N4O3 and a molecular weight of 481.34 g/mol. Its IUPAC name is 3-[[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-1,1-diphenylurea.
| Compound Name | 3-[[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-1,1-diphenylurea |
|---|---|
| PubChem CID | 3695427 |
| Molecular Formula | C24H18Cl2N4O3 |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 3-[[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-1,1-diphenylurea |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)NNC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H18Cl2N4O3/c1-15-20(22(29-33-15)21-18(25)13-8-14-19(21)26)23(31)27-28-24(32)30(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-14H,1H3,(H,27,31)(H,28,32) |
| InChIKey | JGIOEZSHVVGRFL-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|