C19H13Cl2N5O6 — CID 4617530
N-[[[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]carbamoyl]-4-nitrobenzamide (PubChem CID 4617530) has the molecular formula C19H13Cl2N5O6 and a molecular weight of 478.25 g/mol. Its IUPAC name is N-[[[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]carbamoyl]-4-nitrobenzamide.
| Compound Name | N-[[[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]carbamoyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 4617530 |
| Molecular Formula | C19H13Cl2N5O6 |
| Molecular Weight | 478.25 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | N-[[[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]carbamoyl]-4-nitrobenzamide |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)NNC(=O)NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H13Cl2N5O6/c1-9-14(16(25-32-9)15-12(20)3-2-4-13(15)21)18(28)23-24-19(29)22-17(27)10-5-7-11(8-6-10)26(30)31/h2-8H,1H3,(H,23,28)(H2,22,24,27,29) |
| InChIKey | NHOVQPJJOJAIDT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 156.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|