C16H18Cl2N4O3 — CID 2798113
1-tert-butyl-3-[[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]urea (PubChem CID 2798113) has the molecular formula C16H18Cl2N4O3 and a molecular weight of 385.25 g/mol. Its IUPAC name is 1-tert-butyl-3-[[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]urea.
| Compound Name | 1-tert-butyl-3-[[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]urea |
|---|---|
| PubChem CID | 2798113 |
| Molecular Formula | C16H18Cl2N4O3 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 1-tert-butyl-3-[[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]urea |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)NNC(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H18Cl2N4O3/c1-8-11(14(23)20-21-15(24)19-16(2,3)4)13(22-25-8)12-9(17)6-5-7-10(12)18/h5-7H,1-4H3,(H,20,23)(H2,19,21,24) |
| InChIKey | JLJSHNPZDOJFRC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|