C12H8BrCl2NO2 — CID 3251399
2-bromo-1-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]ethanone (PubChem CID 3251399) has the molecular formula C12H8BrCl2NO2 and a molecular weight of 349.01 g/mol. Its IUPAC name is 2-bromo-1-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]ethanone.
| Compound Name | 2-bromo-1-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]ethanone |
|---|---|
| PubChem CID | 3251399 |
| Molecular Formula | C12H8BrCl2NO2 |
| Molecular Weight | 349.01 g/mol |
| Exact Mass | 346.91 |
| IUPAC Name | 2-bromo-1-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]ethanone |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)CBr |
| InChI | InChI=1S/C12H8BrCl2NO2/c1-6-10(9(17)5-13)12(16-18-6)11-7(14)3-2-4-8(11)15/h2-4H,5H2,1H3 |
| InChIKey | AYIUSXHCQDHPHG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.01 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|