C13H10Cl3N3O3 — CID 2781697
[[amino-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]methylidene]amino] 2-chloroacetate (PubChem CID 2781697) has the molecular formula C13H10Cl3N3O3 and a molecular weight of 362.60 g/mol. Its IUPAC name is [[amino-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]methylidene]amino] 2-chloroacetate.
| Compound Name | [[amino-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]methylidene]amino] 2-chloroacetate |
|---|---|
| PubChem CID | 2781697 |
| Molecular Formula | C13H10Cl3N3O3 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | [[amino-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]methylidene]amino] 2-chloroacetate |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(N)=NOC(=O)CCl |
| InChI | InChI=1S/C13H10Cl3N3O3/c1-6-10(13(17)19-22-9(20)5-14)12(18-21-6)11-7(15)3-2-4-8(11)16/h2-4H,5H2,1H3,(H2,17,19) |
| InChIKey | RVSHSRSBDVNYDM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|