C18H13Cl3N3O2+ — CID 7037414
[amino-(4-chlorophenyl)methylidene]-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]azanium (PubChem CID 7037414) has the molecular formula C18H13Cl3N3O2+ and a molecular weight of 409.68 g/mol. Its IUPAC name is [amino-(4-chlorophenyl)methylidene]-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]azanium.
| Compound Name | [amino-(4-chlorophenyl)methylidene]-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]azanium |
|---|---|
| PubChem CID | 7037414 |
| Molecular Formula | C18H13Cl3N3O2+ |
| Molecular Weight | 409.68 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | [amino-(4-chlorophenyl)methylidene]-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]azanium |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)/[NH+]=C(\N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H12Cl3N3O2/c1-9-14(16(24-26-9)15-12(20)3-2-4-13(15)21)18(25)23-17(22)10-5-7-11(19)8-6-10/h2-8H,1H3,(H2,22,23,25)/p+1 |
| InChIKey | WYMOMDUBODWRRF-UHFFFAOYSA-O |
| XLogP | 3.24 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.68 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|