C18H12Cl2N4O2S — CID 56687847
N'-(1,3-benzothiazol-2-yl)-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbohydrazide (PubChem CID 56687847) has the molecular formula C18H12Cl2N4O2S and a molecular weight of 419.29 g/mol. Its IUPAC name is N'-(1,3-benzothiazol-2-yl)-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbohydrazide.
| Compound Name | N'-(1,3-benzothiazol-2-yl)-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 56687847 |
| Molecular Formula | C18H12Cl2N4O2S |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | N'-(1,3-benzothiazol-2-yl)-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbohydrazide |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)NNc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H12Cl2N4O2S/c1-9-14(16(24-26-9)15-10(19)5-4-6-11(15)20)17(25)22-23-18-21-12-7-2-3-8-13(12)27-18/h2-8H,1H3,(H,21,23)(H,22,25) |
| InChIKey | BBKKWKDGVMEQHV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|