C21H19Cl2N3O5 — CID 55572324
3-(2,6-dichlorophenyl)-N'-[2-(2-ethoxyphenoxy)acetyl]-5-methyl-1,2-oxazole-4-carbohydrazide (PubChem CID 55572324) has the molecular formula C21H19Cl2N3O5 and a molecular weight of 464.31 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N'-[2-(2-ethoxyphenoxy)acetyl]-5-methyl-1,2-oxazole-4-carbohydrazide.
| Compound Name | 3-(2,6-dichlorophenyl)-N'-[2-(2-ethoxyphenoxy)acetyl]-5-methyl-1,2-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55572324 |
| Molecular Formula | C21H19Cl2N3O5 |
| Molecular Weight | 464.31 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N'-[2-(2-ethoxyphenoxy)acetyl]-5-methyl-1,2-oxazole-4-carbohydrazide |
| SMILES | CCOc1ccccc1OCC(=O)NNC(=O)c1c(-c2c(Cl)cccc2Cl)noc1C |
| InChI | InChI=1S/C21H19Cl2N3O5/c1-3-29-15-9-4-5-10-16(15)30-11-17(27)24-25-21(28)18-12(2)31-26-20(18)19-13(22)7-6-8-14(19)23/h4-10H,3,11H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | KQNXVFNKLYJSSY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.31 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|