C20H14Cl4N4O4 — CID 2804484
3-(2,6-dichlorophenyl)-N'-[2-[(2,4-dichlorophenyl)methylideneamino]oxyacetyl]-5-methyl-1,2-oxazole-4-carbohydrazide (PubChem CID 2804484) has the molecular formula C20H14Cl4N4O4 and a molecular weight of 516.17 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N'-[2-[(2,4-dichlorophenyl)methylideneamino]oxyacetyl]-5-methyl-1,2-oxazole-4-carbohydrazide.
| Compound Name | 3-(2,6-dichlorophenyl)-N'-[2-[(2,4-dichlorophenyl)methylideneamino]oxyacetyl]-5-methyl-1,2-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 2804484 |
| Molecular Formula | C20H14Cl4N4O4 |
| Molecular Weight | 516.17 g/mol |
| Exact Mass | 513.98 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N'-[2-[(2,4-dichlorophenyl)methylideneamino]oxyacetyl]-5-methyl-1,2-oxazole-4-carbohydrazide |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)NNC(=O)CON=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H14Cl4N4O4/c1-10-17(19(28-32-10)18-13(22)3-2-4-14(18)23)20(30)27-26-16(29)9-31-25-8-11-5-6-12(21)7-15(11)24/h2-8H,9H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | JKLVNSXPANWZHM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.17 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|