C17H14Cl2N6O4 — CID 20849710
1-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-1-[methyl-(5-nitro-2-pyridinyl)amino]urea (PubChem CID 20849710) has the molecular formula C17H14Cl2N6O4 and a molecular weight of 437.24 g/mol. Its IUPAC name is 1-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-1-[methyl-(5-nitro-2-pyridinyl)amino]urea.
| Compound Name | 1-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-1-[methyl-(5-nitro-2-pyridinyl)amino]urea |
|---|---|
| PubChem CID | 20849710 |
| Molecular Formula | C17H14Cl2N6O4 |
| Molecular Weight | 437.24 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 1-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-1-[methyl-(5-nitro-2-pyridinyl)amino]urea |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1N(C(N)=O)N(C)c1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C17H14Cl2N6O4/c1-9-16(15(22-29-9)14-11(18)4-3-5-12(14)19)24(17(20)26)23(2)13-7-6-10(8-21-13)25(27)28/h3-8H,1-2H3,(H2,20,26) |
| InChIKey | WHTCXHUCEBLLEA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 131.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.24 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|