C19H16ClN3O4 — CID 118060531
[(Z)-[amino-(3-methoxyphenyl)methylidene]amino] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 118060531) has the molecular formula C19H16ClN3O4 and a molecular weight of 385.81 g/mol. Its IUPAC name is [(Z)-[amino-(3-methoxyphenyl)methylidene]amino] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | [(Z)-[amino-(3-methoxyphenyl)methylidene]amino] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 118060531 |
| Molecular Formula | C19H16ClN3O4 |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | [(Z)-[amino-(3-methoxyphenyl)methylidene]amino] 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | COc1cccc(/C(N)=N/OC(=O)c2c(-c3ccccc3Cl)noc2C)c1 |
| InChI | InChI=1S/C19H16ClN3O4/c1-11-16(17(22-26-11)14-8-3-4-9-15(14)20)19(24)27-23-18(21)12-6-5-7-13(10-12)25-2/h3-10H,1-2H3,(H2,21,23) |
| InChIKey | JNDQGKLPKUVKND-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|