C14H12ClNO2 — CID 11032674
1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]but-3-en-1-one (PubChem CID 11032674) has the molecular formula C14H12ClNO2 and a molecular weight of 261.71 g/mol. Its IUPAC name is 1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]but-3-en-1-one.
| Compound Name | 1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]but-3-en-1-one |
|---|---|
| PubChem CID | 11032674 |
| Molecular Formula | C14H12ClNO2 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]but-3-en-1-one |
| SMILES | C=CCC(=O)c1c(-c2ccccc2Cl)noc1C |
| InChI | InChI=1S/C14H12ClNO2/c1-3-6-12(17)13-9(2)18-16-14(13)10-7-4-5-8-11(10)15/h3-5,7-8H,1,6H2,2H3 |
| InChIKey | QWOSUUBIYNWPOZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|