C13H11NO3S — CID 15750360
6,7-dimethoxy-3-thiophen-2-yl-1,2-benzoxazole (PubChem CID 15750360) has the molecular formula C13H11NO3S and a molecular weight of 261.30 g/mol. Its IUPAC name is 6,7-dimethoxy-3-thiophen-2-yl-1,2-benzoxazole.
| Compound Name | 6,7-dimethoxy-3-thiophen-2-yl-1,2-benzoxazole |
|---|---|
| PubChem CID | 15750360 |
| Molecular Formula | C13H11NO3S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 6,7-dimethoxy-3-thiophen-2-yl-1,2-benzoxazole |
| SMILES | COc1ccc2c(-c3cccs3)noc2c1OC |
| InChI | InChI=1S/C13H11NO3S/c1-15-9-6-5-8-11(10-4-3-7-18-10)14-17-12(8)13(9)16-2/h3-7H,1-2H3 |
| InChIKey | JVWMMGGFLZNPED-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |