C11H6ClNO2S — CID 173447007
7-chloro-3-thiophen-2-yl-1,2-benzoxazol-6-ol (PubChem CID 173447007) has the molecular formula C11H6ClNO2S and a molecular weight of 251.69 g/mol. Its IUPAC name is 7-chloro-3-thiophen-2-yl-1,2-benzoxazol-6-ol.
| Compound Name | 7-chloro-3-thiophen-2-yl-1,2-benzoxazol-6-ol |
|---|---|
| PubChem CID | 173447007 |
| Molecular Formula | C11H6ClNO2S |
| Molecular Weight | 251.69 g/mol |
| Exact Mass | 250.98 |
| IUPAC Name | 7-chloro-3-thiophen-2-yl-1,2-benzoxazol-6-ol |
| SMILES | Oc1ccc2c(-c3cccs3)noc2c1Cl |
| InChI | InChI=1S/C11H6ClNO2S/c12-9-7(14)4-3-6-10(13-15-11(6)9)8-2-1-5-16-8/h1-5,14H |
| InChIKey | PEXINFFZUQLSGA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.69 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |