C13H9NO2 — CID 105464793
3-phenyl-1,2-benzoxazol-7-ol (PubChem CID 105464793) has the molecular formula C13H9NO2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-phenyl-1,2-benzoxazol-7-ol.
| Compound Name | 3-phenyl-1,2-benzoxazol-7-ol |
|---|---|
| PubChem CID | 105464793 |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 3-phenyl-1,2-benzoxazol-7-ol |
| SMILES | Oc1cccc2c(-c3ccccc3)noc12 |
| InChI | InChI=1S/C13H9NO2/c15-11-8-4-7-10-12(14-16-13(10)11)9-5-2-1-3-6-9/h1-8,15H |
| InChIKey | RVPAZGKWMCBGLC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |