C15H18N2O — CID 175235324
methanamine;methane;3-phenyl-1,2-benzoxazole (PubChem CID 175235324) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is methanamine;methane;3-phenyl-1,2-benzoxazole.
| Compound Name | methanamine;methane;3-phenyl-1,2-benzoxazole |
|---|---|
| PubChem CID | 175235324 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | methanamine;methane;3-phenyl-1,2-benzoxazole |
| SMILES | C.CN.c1ccc(-c2noc3ccccc23)cc1 |
| InChI | InChI=1S/C13H9NO.CH5N.CH4/c1-2-6-10(7-3-1)13-11-8-4-5-9-12(11)15-14-13;1-2;/h1-9H;2H2,1H3;1H4 |
| InChIKey | NXZMNYBADUADSB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |