About 6-chloro-3-phenyl-1,2-benzoxazole;methanamine;prop-1-ene
6-chloro-3-phenyl-1,2-benzoxazole;methanamine;prop-1-ene (PubChem CID 174369929) has the molecular formula C17H19ClN2O
and a molecular weight of 302.81 g/mol. Its IUPAC name is 6-chloro-3-phenyl-1,2-benzoxazole;methanamine;prop-1-ene.
Molecular Properties
| Compound Name | 6-chloro-3-phenyl-1,2-benzoxazole;methanamine;prop-1-ene |
| PubChem CID | 174369929 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 6-chloro-3-phenyl-1,2-benzoxazole;methanamine;prop-1-ene |
| SMILES | C=CC.CN.Clc1ccc2c(-c3ccccc3)noc2c1 |
| InChI | InChI=1S/C13H8ClNO.C3H6.CH5N/c14-10-6-7-11-12(8-10)16-15-13(11)9-4-2-1-3-5-9;1-3-2;1-2/h1-8H;3H,1H2,2H3;2H2,1H3 |
| InChIKey | UCXQJWAFXPNRIK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-phenyl-1,2-benzoxazole;methanamine;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-phenyl-1,2-benzoxazole;methanamine;prop-1-ene?
The IUPAC name of 6-chloro-3-phenyl-1,2-benzoxazole;methanamine;prop-1-ene (CID 174369929) is 6-chloro-3-phenyl-1,2-benzoxazole;methanamine;prop-1-ene.
What is the SMILES notation for 6-chloro-3-phenyl-1,2-benzoxazole;methanamine;prop-1-ene?
The canonical SMILES for 6-chloro-3-phenyl-1,2-benzoxazole;methanamine;prop-1-ene is C=CC.CN.Clc1ccc2c(-c3ccccc3)noc2c1.
What is the InChIKey of 6-chloro-3-phenyl-1,2-benzoxazole;methanamine;prop-1-ene?
The InChIKey is UCXQJWAFXPNRIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClNO.C3H6.CH5N/c14-10-6-7-11-12(8-10)16-15-13(11)9-4-2-1-3-5-9;1-3-2;1-2/h1-8H;3H,1H2,2H3;2H2,1H3.
What are the key properties of 6-chloro-3-phenyl-1,2-benzoxazole;methanamine;prop-1-ene?
6-chloro-3-phenyl-1,2-benzoxazole;methanamine;prop-1-ene has a molecular weight of 302.81 g/mol, XLogP of 4.92, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-phenyl-1,2-benzoxazole;methanamine;prop-1-ene is sourced from PubChem (CID 174369929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).