C17H19ClN2O — CID 174369929
6-chloro-3-phenyl-1,2-benzoxazole;methanamine;prop-1-ene (PubChem CID 174369929) has the molecular formula C17H19ClN2O and a molecular weight of 302.81 g/mol. Its IUPAC name is 6-chloro-3-phenyl-1,2-benzoxazole;methanamine;prop-1-ene.
| Compound Name | 6-chloro-3-phenyl-1,2-benzoxazole;methanamine;prop-1-ene |
|---|---|
| PubChem CID | 174369929 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 6-chloro-3-phenyl-1,2-benzoxazole;methanamine;prop-1-ene |
| SMILES | C=CC.CN.Clc1ccc2c(-c3ccccc3)noc2c1 |
| InChI | InChI=1S/C13H8ClNO.C3H6.CH5N/c14-10-6-7-11-12(8-10)16-15-13(11)9-4-2-1-3-5-9;1-3-2;1-2/h1-8H;3H,1H2,2H3;2H2,1H3 |
| InChIKey | UCXQJWAFXPNRIK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|