C11H7ClN4O — CID 13333152
5-(5-chloro-1,2-benzoxazol-3-yl)pyrimidin-2-amine (PubChem CID 13333152) has the molecular formula C11H7ClN4O and a molecular weight of 246.66 g/mol. Its IUPAC name is 5-(5-chloro-1,2-benzoxazol-3-yl)pyrimidin-2-amine.
| Compound Name | 5-(5-chloro-1,2-benzoxazol-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 13333152 |
| Molecular Formula | C11H7ClN4O |
| Molecular Weight | 246.66 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 5-(5-chloro-1,2-benzoxazol-3-yl)pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2noc3ccc(Cl)cc23)cn1 |
| InChI | InChI=1S/C11H7ClN4O/c12-7-1-2-9-8(3-7)10(16-17-9)6-4-14-11(13)15-5-6/h1-5H,(H2,13,14,15) |
| InChIKey | ZZRGUIHMLCLSDI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.66 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |