C21H13Cl2N — CID 102204844
1,6-dichloro-3,4-diphenylisoquinoline (PubChem CID 102204844) has the molecular formula C21H13Cl2N and a molecular weight of 350.25 g/mol. Its IUPAC name is 1,6-dichloro-3,4-diphenylisoquinoline.
| Compound Name | 1,6-dichloro-3,4-diphenylisoquinoline |
|---|---|
| PubChem CID | 102204844 |
| Molecular Formula | C21H13Cl2N |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 1,6-dichloro-3,4-diphenylisoquinoline |
| SMILES | Clc1ccc2c(Cl)nc(-c3ccccc3)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C21H13Cl2N/c22-16-11-12-17-18(13-16)19(14-7-3-1-4-8-14)20(24-21(17)23)15-9-5-2-6-10-15/h1-13H |
| InChIKey | FITGAHUUYAKFSZ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|