C24H20ClNO3 — CID 101082516
1-chloro-7-methoxy-3,4-bis(4-methoxyphenyl)isoquinoline (PubChem CID 101082516) has the molecular formula C24H20ClNO3 and a molecular weight of 405.88 g/mol. Its IUPAC name is 1-chloro-7-methoxy-3,4-bis(4-methoxyphenyl)isoquinoline.
| Compound Name | 1-chloro-7-methoxy-3,4-bis(4-methoxyphenyl)isoquinoline |
|---|---|
| PubChem CID | 101082516 |
| Molecular Formula | C24H20ClNO3 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 1-chloro-7-methoxy-3,4-bis(4-methoxyphenyl)isoquinoline |
| SMILES | COc1ccc(-c2nc(Cl)c3cc(OC)ccc3c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H20ClNO3/c1-27-17-8-4-15(5-9-17)22-20-13-12-19(29-3)14-21(20)24(25)26-23(22)16-6-10-18(28-2)11-7-16/h4-14H,1-3H3 |
| InChIKey | ZQCSAMDGLNSMTM-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|