C21H22ClNO2 — CID 86683171
1-chloro-4,6-dimethoxy-3-[4-(2-methylpropyl)phenyl]isoquinoline (PubChem CID 86683171) has the molecular formula C21H22ClNO2 and a molecular weight of 355.87 g/mol. Its IUPAC name is 1-chloro-4,6-dimethoxy-3-[4-(2-methylpropyl)phenyl]isoquinoline.
| Compound Name | 1-chloro-4,6-dimethoxy-3-[4-(2-methylpropyl)phenyl]isoquinoline |
|---|---|
| PubChem CID | 86683171 |
| Molecular Formula | C21H22ClNO2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 1-chloro-4,6-dimethoxy-3-[4-(2-methylpropyl)phenyl]isoquinoline |
| SMILES | COc1ccc2c(Cl)nc(-c3ccc(CC(C)C)cc3)c(OC)c2c1 |
| InChI | InChI=1S/C21H22ClNO2/c1-13(2)11-14-5-7-15(8-6-14)19-20(25-4)18-12-16(24-3)9-10-17(18)21(22)23-19/h5-10,12-13H,11H2,1-4H3 |
| InChIKey | IYISNCAHGCPOLN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|