C20H28ClNO — CID 161342244
2-chloro-5-(2-methylpropyl)pyridine;1-methoxy-4-(2-methylpropyl)benzene (PubChem CID 161342244) has the molecular formula C20H28ClNO and a molecular weight of 333.90 g/mol. Its IUPAC name is 2-chloro-5-(2-methylpropyl)pyridine;1-methoxy-4-(2-methylpropyl)benzene.
| Compound Name | 2-chloro-5-(2-methylpropyl)pyridine;1-methoxy-4-(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 161342244 |
| Molecular Formula | C20H28ClNO |
| Molecular Weight | 333.90 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 2-chloro-5-(2-methylpropyl)pyridine;1-methoxy-4-(2-methylpropyl)benzene |
| SMILES | CC(C)Cc1ccc(Cl)nc1.COc1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C11H16O.C9H12ClN/c1-9(2)8-10-4-6-11(12-3)7-5-10;1-7(2)5-8-3-4-9(10)11-6-8/h4-7,9H,8H2,1-3H3;3-4,6-7H,5H2,1-2H3 |
| InChIKey | VMVAWFXVEOUVKN-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.90 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|