C16H18ClN3O3 — CID 135238768
1-(6-chloro-3-pyridinyl)-3-[1-hydroxy-3-(4-methoxyphenyl)propan-2-yl]urea (PubChem CID 135238768) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is 1-(6-chloro-3-pyridinyl)-3-[1-hydroxy-3-(4-methoxyphenyl)propan-2-yl]urea.
| Compound Name | 1-(6-chloro-3-pyridinyl)-3-[1-hydroxy-3-(4-methoxyphenyl)propan-2-yl]urea |
|---|---|
| PubChem CID | 135238768 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 1-(6-chloro-3-pyridinyl)-3-[1-hydroxy-3-(4-methoxyphenyl)propan-2-yl]urea |
| SMILES | COc1ccc(CC(CO)NC(=O)Nc2ccc(Cl)nc2)cc1 |
| InChI | InChI=1S/C16H18ClN3O3/c1-23-14-5-2-11(3-6-14)8-13(10-21)20-16(22)19-12-4-7-15(17)18-9-12/h2-7,9,13,21H,8,10H2,1H3,(H2,19,20,22) |
| InChIKey | OBVGSIDKTJOUDE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|