C21H18ClF2N3O3 — CID 78892694
1-[(6-chloro-3-pyridinyl)methyl]-3-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]urea (PubChem CID 78892694) has the molecular formula C21H18ClF2N3O3 and a molecular weight of 433.84 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-3-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]urea.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-3-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]urea |
|---|---|
| PubChem CID | 78892694 |
| Molecular Formula | C21H18ClF2N3O3 |
| Molecular Weight | 433.84 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-3-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]urea |
| SMILES | COc1ccc(-c2cc(NC(=O)NCc3ccc(Cl)nc3)ccc2OC(F)F)cc1 |
| InChI | InChI=1S/C21H18ClF2N3O3/c1-29-16-6-3-14(4-7-16)17-10-15(5-8-18(17)30-20(23)24)27-21(28)26-12-13-2-9-19(22)25-11-13/h2-11,20H,12H2,1H3,(H2,26,27,28) |
| InChIKey | DDXXXQQADPSLNR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.84 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|