C25H19F2N3O3 — CID 26686995
(E)-N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-3-quinoxalin-2-ylprop-2-enamide (PubChem CID 26686995) has the molecular formula C25H19F2N3O3 and a molecular weight of 447.44 g/mol. Its IUPAC name is (E)-N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-3-quinoxalin-2-ylprop-2-enamide.
| Compound Name | (E)-N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-3-quinoxalin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 26686995 |
| Molecular Formula | C25H19F2N3O3 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (E)-N-[4-(difluoromethoxy)-3-(4-methoxyphenyl)phenyl]-3-quinoxalin-2-ylprop-2-enamide |
| SMILES | COc1ccc(-c2cc(NC(=O)/C=C/c3cnc4ccccc4n3)ccc2OC(F)F)cc1 |
| InChI | InChI=1S/C25H19F2N3O3/c1-32-19-10-6-16(7-11-19)20-14-17(8-12-23(20)33-25(26)27)30-24(31)13-9-18-15-28-21-4-2-3-5-22(21)29-18/h2-15,25H,1H3,(H,30,31)/b13-9+ |
| InChIKey | UDFVTHVLAHKJID-UKTHLTGXSA-N |
| XLogP | 5.56 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|