C25H22ClNO — CID 154487575
1-chloro-3-(2,6-dimethylphenyl)-4-(3-methoxyphenyl)-6-methylisoquinoline (PubChem CID 154487575) has the molecular formula C25H22ClNO and a molecular weight of 387.91 g/mol. Its IUPAC name is 1-chloro-3-(2,6-dimethylphenyl)-4-(3-methoxyphenyl)-6-methylisoquinoline.
| Compound Name | 1-chloro-3-(2,6-dimethylphenyl)-4-(3-methoxyphenyl)-6-methylisoquinoline |
|---|---|
| PubChem CID | 154487575 |
| Molecular Formula | C25H22ClNO |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 1-chloro-3-(2,6-dimethylphenyl)-4-(3-methoxyphenyl)-6-methylisoquinoline |
| SMILES | COc1cccc(-c2c(-c3c(C)cccc3C)nc(Cl)c3ccc(C)cc23)c1 |
| InChI | InChI=1S/C25H22ClNO/c1-15-11-12-20-21(13-15)23(18-9-6-10-19(14-18)28-4)24(27-25(20)26)22-16(2)7-5-8-17(22)3/h5-14H,1-4H3 |
| InChIKey | NKLQCNOUZWAXOX-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|