C15H13ClN2O — CID 94282086
2-chloro-6-(3-methoxyphenyl)-4,5-dimethylpyridine-3-carbonitrile (PubChem CID 94282086) has the molecular formula C15H13ClN2O and a molecular weight of 272.74 g/mol. Its IUPAC name is 2-chloro-6-(3-methoxyphenyl)-4,5-dimethylpyridine-3-carbonitrile.
| Compound Name | 2-chloro-6-(3-methoxyphenyl)-4,5-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 94282086 |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-chloro-6-(3-methoxyphenyl)-4,5-dimethylpyridine-3-carbonitrile |
| SMILES | COc1cccc(-c2nc(Cl)c(C#N)c(C)c2C)c1 |
| InChI | InChI=1S/C15H13ClN2O/c1-9-10(2)14(18-15(16)13(9)8-17)11-5-4-6-12(7-11)19-3/h4-7H,1-3H3 |
| InChIKey | XYGQDWWVNSYFHE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|