C12H9N3O2 — CID 135518067
4-(3-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 135518067) has the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(3-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 135518067 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 4-(3-methoxyphenyl)-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1cccc(-c2nc[nH]c(=O)c2C#N)c1 |
| InChI | InChI=1S/C12H9N3O2/c1-17-9-4-2-3-8(5-9)11-10(6-13)12(16)15-7-14-11/h2-5,7H,1H3,(H,14,15,16) |
| InChIKey | RCWLDYNGEJYQCB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |