C13H11N3O2 — CID 135836115
6-(3-methoxyphenyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 135836115) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 6-(3-methoxyphenyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 6-(3-methoxyphenyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135836115 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 6-(3-methoxyphenyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | COc1cccc(-c2cc3c(=O)[nH]cnc3[nH]2)c1 |
| InChI | InChI=1S/C13H11N3O2/c1-18-9-4-2-3-8(5-9)11-6-10-12(16-11)14-7-15-13(10)17/h2-7H,1H3,(H2,14,15,16,17) |
| InChIKey | AWTJSTYWTOXEAB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |