C19H16N4O2 — CID 46855835
3-[4-(3-methoxyphenoxy)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]aniline (PubChem CID 46855835) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-[4-(3-methoxyphenoxy)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]aniline.
| Compound Name | 3-[4-(3-methoxyphenoxy)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]aniline |
|---|---|
| PubChem CID | 46855835 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3-[4-(3-methoxyphenoxy)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]aniline |
| SMILES | COc1cccc(Oc2ncnc3[nH]c(-c4cccc(N)c4)cc23)c1 |
| InChI | InChI=1S/C19H16N4O2/c1-24-14-6-3-7-15(9-14)25-19-16-10-17(23-18(16)21-11-22-19)12-4-2-5-13(20)8-12/h2-11H,20H2,1H3,(H,21,22,23) |
| InChIKey | PVXBFWPQKQQJQX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|