C27H19N3O2 — CID 176522061
2,6-bis(3-methoxyphenyl)-4-phenylpyridine-3,5-dicarbonitrile (PubChem CID 176522061) has the molecular formula C27H19N3O2 and a molecular weight of 417.47 g/mol. Its IUPAC name is 2,6-bis(3-methoxyphenyl)-4-phenylpyridine-3,5-dicarbonitrile.
| Compound Name | 2,6-bis(3-methoxyphenyl)-4-phenylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 176522061 |
| Molecular Formula | C27H19N3O2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2,6-bis(3-methoxyphenyl)-4-phenylpyridine-3,5-dicarbonitrile |
| SMILES | COc1cccc(-c2nc(-c3cccc(OC)c3)c(C#N)c(-c3ccccc3)c2C#N)c1 |
| InChI | InChI=1S/C27H19N3O2/c1-31-21-12-6-10-19(14-21)26-23(16-28)25(18-8-4-3-5-9-18)24(17-29)27(30-26)20-11-7-13-22(15-20)32-2/h3-15H,1-2H3 |
| InChIKey | LNRGAKLGCCMSBV-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 78.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |