C25H13I2N3 — CID 176522065
2,6-bis(3-iodophenyl)-4-phenylpyridine-3,5-dicarbonitrile (PubChem CID 176522065) has the molecular formula C25H13I2N3 and a molecular weight of 609.21 g/mol. Its IUPAC name is 2,6-bis(3-iodophenyl)-4-phenylpyridine-3,5-dicarbonitrile.
| Compound Name | 2,6-bis(3-iodophenyl)-4-phenylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 176522065 |
| Molecular Formula | C25H13I2N3 |
| Molecular Weight | 609.21 g/mol |
| Exact Mass | 608.92 |
| IUPAC Name | 2,6-bis(3-iodophenyl)-4-phenylpyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(-c2cccc(I)c2)nc(-c2cccc(I)c2)c(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C25H13I2N3/c26-19-10-4-8-17(12-19)24-21(14-28)23(16-6-2-1-3-7-16)22(15-29)25(30-24)18-9-5-11-20(27)13-18/h1-13H |
| InChIKey | YFDCVRMHGNWTAX-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.21 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|