About 3-methyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile
3-methyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile (PubChem CID 132530624) has the molecular formula C20H14N4
and a molecular weight of 310.36 g/mol. Its IUPAC name is 3-methyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile.
Molecular Properties
| Compound Name | 3-methyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile |
| PubChem CID | 132530624 |
| Molecular Formula | C20H14N4 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 3-methyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile |
| SMILES | Cc1[nH]nc2nc(-c3ccccc3)c(C#N)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C20H14N4/c1-13-17-18(14-8-4-2-5-9-14)16(12-21)19(22-20(17)24-23-13)15-10-6-3-7-11-15/h2-11H,1H3,(H,22,23,24) |
| InChIKey | LLHOBBAOOLYNKS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile?
The IUPAC name of 3-methyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile (CID 132530624) is 3-methyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile.
What is the SMILES notation for 3-methyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile?
The canonical SMILES for 3-methyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile is Cc1[nH]nc2nc(-c3ccccc3)c(C#N)c(-c3ccccc3)c12.
What is the InChIKey of 3-methyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile?
The InChIKey is LLHOBBAOOLYNKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N4/c1-13-17-18(14-8-4-2-5-9-14)16(12-21)19(22-20(17)24-23-13)15-10-6-3-7-11-15/h2-11H,1H3,(H,22,23,24).
What are the key properties of 3-methyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile?
3-methyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile has a molecular weight of 310.36 g/mol, XLogP of 4.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4,6-diphenyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile is sourced from PubChem (CID 132530624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).