C25H22ClFN6O2 — CID 160983720
6-(2-fluoro-4-nitrophenyl)-3-methyl-4-(4-piperidin-1-ylphenyl)-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile;hydrochloride (PubChem CID 160983720) has the molecular formula C25H22ClFN6O2 and a molecular weight of 492.94 g/mol. Its IUPAC name is 6-(2-fluoro-4-nitrophenyl)-3-methyl-4-(4-piperidin-1-ylphenyl)-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile;hydrochloride.
| Compound Name | 6-(2-fluoro-4-nitrophenyl)-3-methyl-4-(4-piperidin-1-ylphenyl)-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 160983720 |
| Molecular Formula | C25H22ClFN6O2 |
| Molecular Weight | 492.94 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 6-(2-fluoro-4-nitrophenyl)-3-methyl-4-(4-piperidin-1-ylphenyl)-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile;hydrochloride |
| SMILES | Cc1[nH]nc2nc(-c3ccc([N+](=O)[O-])cc3F)c(C#N)c(-c3ccc(N4CCCCC4)cc3)c12.Cl |
| InChI | InChI=1S/C25H21FN6O2.ClH/c1-15-22-23(16-5-7-17(8-6-16)31-11-3-2-4-12-31)20(14-27)24(28-25(22)30-29-15)19-10-9-18(32(33)34)13-21(19)26;/h5-10,13H,2-4,11-12H2,1H3,(H,28,29,30);1H |
| InChIKey | GKAIKINLJNKWTL-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 111.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.94 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|