C30H23FN6O3 — CID 158096616
6-(2-fluoro-4-hydroxyphenyl)-3-(4-nitrophenyl)-4-(4-piperidin-1-ylphenyl)-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile (PubChem CID 158096616) has the molecular formula C30H23FN6O3 and a molecular weight of 534.55 g/mol. Its IUPAC name is 6-(2-fluoro-4-hydroxyphenyl)-3-(4-nitrophenyl)-4-(4-piperidin-1-ylphenyl)-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile.
| Compound Name | 6-(2-fluoro-4-hydroxyphenyl)-3-(4-nitrophenyl)-4-(4-piperidin-1-ylphenyl)-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 158096616 |
| Molecular Formula | C30H23FN6O3 |
| Molecular Weight | 534.55 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 6-(2-fluoro-4-hydroxyphenyl)-3-(4-nitrophenyl)-4-(4-piperidin-1-ylphenyl)-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(O)cc2F)nc2n[nH]c(-c3ccc([N+](=O)[O-])cc3)c2c1-c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C30H23FN6O3/c31-25-16-22(38)12-13-23(25)29-24(17-32)26(18-4-8-20(9-5-18)36-14-2-1-3-15-36)27-28(34-35-30(27)33-29)19-6-10-21(11-7-19)37(39)40/h4-13,16,38H,1-3,14-15H2,(H,33,34,35) |
| InChIKey | FOSZAYIHYWUEOU-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 131.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.55 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|