C28H20F3N5O — CID 159104184
3-(furan-2-yl)-4-(4-piperidin-1-ylphenyl)-6-(2,3,6-trifluorophenyl)-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile (PubChem CID 159104184) has the molecular formula C28H20F3N5O and a molecular weight of 499.50 g/mol. Its IUPAC name is 3-(furan-2-yl)-4-(4-piperidin-1-ylphenyl)-6-(2,3,6-trifluorophenyl)-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile.
| Compound Name | 3-(furan-2-yl)-4-(4-piperidin-1-ylphenyl)-6-(2,3,6-trifluorophenyl)-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 159104184 |
| Molecular Formula | C28H20F3N5O |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 3-(furan-2-yl)-4-(4-piperidin-1-ylphenyl)-6-(2,3,6-trifluorophenyl)-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile |
| SMILES | N#Cc1c(-c2c(F)ccc(F)c2F)nc2n[nH]c(-c3ccco3)c2c1-c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C28H20F3N5O/c29-19-10-11-20(30)25(31)23(19)26-18(15-32)22(16-6-8-17(9-7-16)36-12-2-1-3-13-36)24-27(21-5-4-14-37-21)34-35-28(24)33-26/h4-11,14H,1-3,12-13H2,(H,33,34,35) |
| InChIKey | KDQZYOVWLWHVME-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 81.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|