C14H10N6O2 — CID 54752600
6-amino-3-methyl-4-(4-nitrophenyl)-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile (PubChem CID 54752600) has the molecular formula C14H10N6O2 and a molecular weight of 294.27 g/mol. Its IUPAC name is 6-amino-3-methyl-4-(4-nitrophenyl)-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile.
| Compound Name | 6-amino-3-methyl-4-(4-nitrophenyl)-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 54752600 |
| Molecular Formula | C14H10N6O2 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 6-amino-3-methyl-4-(4-nitrophenyl)-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile |
| SMILES | Cc1[nH]nc2nc(N)c(C#N)c(-c3ccc([N+](=O)[O-])cc3)c12 |
| InChI | InChI=1S/C14H10N6O2/c1-7-11-12(8-2-4-9(5-3-8)20(21)22)10(6-15)13(16)17-14(11)19-18-7/h2-5H,1H3,(H3,16,17,18,19) |
| InChIKey | LONADRCBHRHJCC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|