C20H16N4O2 — CID 5172953
2-amino-5-methyl-6-(4-methylphenyl)-4-(4-nitrophenyl)pyridine-3-carbonitrile (PubChem CID 5172953) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-amino-5-methyl-6-(4-methylphenyl)-4-(4-nitrophenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-5-methyl-6-(4-methylphenyl)-4-(4-nitrophenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5172953 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-amino-5-methyl-6-(4-methylphenyl)-4-(4-nitrophenyl)pyridine-3-carbonitrile |
| SMILES | Cc1ccc(-c2nc(N)c(C#N)c(-c3ccc([N+](=O)[O-])cc3)c2C)cc1 |
| InChI | InChI=1S/C20H16N4O2/c1-12-3-5-15(6-4-12)19-13(2)18(17(11-21)20(22)23-19)14-7-9-16(10-8-14)24(25)26/h3-10H,1-2H3,(H2,22,23) |
| InChIKey | DDYMITZPMOZPDJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|